C23H23N4O3+ — CID 7982374
(1S,5R,6R)-2-amino-4,4-diethoxy-6-(3-phenoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 7982374) has the molecular formula C23H23N4O3+ and a molecular weight of 403.46 g/mol. Its IUPAC name is (1S,5R,6R)-2-amino-4,4-diethoxy-6-(3-phenoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6R)-2-amino-4,4-diethoxy-6-(3-phenoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 7982374 |
| Molecular Formula | C23H23N4O3+ |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (1S,5R,6R)-2-amino-4,4-diethoxy-6-(3-phenoxyphenyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)[NH+]=C(N)[C@@]2(C#N)[C@@H](c3cccc(Oc4ccccc4)c3)[C@@]12C#N |
| InChI | InChI=1S/C23H22N4O3/c1-3-28-23(29-4-2)22(15-25)19(21(22,14-24)20(26)27-23)16-9-8-12-18(13-16)30-17-10-6-5-7-11-17/h5-13,19H,3-4H2,1-2H3,(H2,26,27)/p+1/t19-,21-,22-/m1/s1 |
| InChIKey | AERVTMBTUYVKII-CEMLEFRQSA-O |
| XLogP | 1.77 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|