C17H17N4O4+ — CID 7127472
methyl 4-[(1S,5R,6R)-2-amino-1,5-dicyano-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-en-6-yl]benzoate (PubChem CID 7127472) has the molecular formula C17H17N4O4+ and a molecular weight of 341.35 g/mol. Its IUPAC name is methyl 4-[(1S,5R,6R)-2-amino-1,5-dicyano-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-en-6-yl]benzoate.
| Compound Name | methyl 4-[(1S,5R,6R)-2-amino-1,5-dicyano-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-en-6-yl]benzoate |
|---|---|
| PubChem CID | 7127472 |
| Molecular Formula | C17H17N4O4+ |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | methyl 4-[(1S,5R,6R)-2-amino-1,5-dicyano-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-en-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2[C@]3(C#N)C(N)=[NH+]C(OC)(OC)[C@]23C#N)cc1 |
| InChI | InChI=1S/C17H16N4O4/c1-23-13(22)11-6-4-10(5-7-11)12-15(8-18)14(20)21-17(24-2,25-3)16(12,15)9-19/h4-7,12H,1-3H3,(H2,20,21)/p+1/t12-,15-,16-/m1/s1 |
| InChIKey | YYAPFCSCMMHXDG-DAXOMENPSA-O |
| XLogP | -1.01 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|