About methyl 4-sulfanylbenzoate;hydrochloride
methyl 4-sulfanylbenzoate;hydrochloride (PubChem CID 162200366) has the molecular formula C8H9ClO2S
and a molecular weight of 204.68 g/mol. Its IUPAC name is methyl 4-sulfanylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-sulfanylbenzoate;hydrochloride |
| PubChem CID | 162200366 |
| Molecular Formula | C8H9ClO2S |
| Molecular Weight | 204.68 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | methyl 4-sulfanylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S)cc1.Cl |
| InChI | InChI=1S/C8H8O2S.ClH/c1-10-8(9)6-2-4-7(11)5-3-6;/h2-5,11H,1H3;1H |
| InChIKey | ZRMQDDSFCIUCIY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-sulfanylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-sulfanylbenzoate;hydrochloride?
The IUPAC name of methyl 4-sulfanylbenzoate;hydrochloride (CID 162200366) is methyl 4-sulfanylbenzoate;hydrochloride.
What is the SMILES notation for methyl 4-sulfanylbenzoate;hydrochloride?
The canonical SMILES for methyl 4-sulfanylbenzoate;hydrochloride is COC(=O)c1ccc(S)cc1.Cl.
What is the InChIKey of methyl 4-sulfanylbenzoate;hydrochloride?
The InChIKey is ZRMQDDSFCIUCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S.ClH/c1-10-8(9)6-2-4-7(11)5-3-6;/h2-5,11H,1H3;1H.
What are the key properties of methyl 4-sulfanylbenzoate;hydrochloride?
methyl 4-sulfanylbenzoate;hydrochloride has a molecular weight of 204.68 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-sulfanylbenzoate;hydrochloride is sourced from PubChem (CID 162200366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).