C15H11Cl2N4OS+ — CID 8607470
(1'S,2R,5'R,6'S)-2'-amino-6'-(2,3-dichlorophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8607470) has the molecular formula C15H11Cl2N4OS+ and a molecular weight of 366.25 g/mol. Its IUPAC name is (1'S,2R,5'R,6'S)-2'-amino-6'-(2,3-dichlorophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(2,3-dichlorophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8607470 |
| Molecular Formula | C15H11Cl2N4OS+ |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(2,3-dichlorophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | N#C[C@@]12[C@@H](c3cccc(Cl)c3Cl)[C@]1(C#N)C(N)=[NH+][C@@]21OCCS1 |
| InChI | InChI=1S/C15H10Cl2N4OS/c16-9-3-1-2-8(10(9)17)11-13(6-18)12(20)21-15(14(11,13)7-19)22-4-5-23-15/h1-3,11H,4-5H2,(H2,20,21)/p+1/t11-,13+,14+,15+/m0/s1 |
| InChIKey | UMIGXFWIMYOORP-ZGKBOVNRSA-O |
| XLogP | 0.98 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |