C18H19N4O3S+ — CID 8607963
(1'S,2R,5'R,6'S)-2'-amino-6'-(2,5-dimethoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8607963) has the molecular formula C18H19N4O3S+ and a molecular weight of 371.44 g/mol. Its IUPAC name is (1'S,2R,5'R,6'S)-2'-amino-6'-(2,5-dimethoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(2,5-dimethoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8607963 |
| Molecular Formula | C18H19N4O3S+ |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(2,5-dimethoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | COc1ccc(OC)c([C@]2(C)[C@]3(C#N)C(N)=[NH+][C@@]4(OCCS4)[C@@]32C#N)c1 |
| InChI | InChI=1S/C18H18N4O3S/c1-15(12-8-11(23-2)4-5-13(12)24-3)16(9-19)14(21)22-18(17(15,16)10-20)25-6-7-26-18/h4-5,8H,6-7H2,1-3H3,(H2,21,22)/p+1/t15-,16+,17-,18-/m1/s1 |
| InChIKey | SCHCXGFHRWTCDV-XMTFNYHQSA-O |
| XLogP | -0.14 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |