C16H14FN4O2+ — CID 8608495
(1'S,5'R,6'S)-2'-amino-6'-(4-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8608495) has the molecular formula C16H14FN4O2+ and a molecular weight of 313.31 g/mol. Its IUPAC name is (1'S,5'R,6'S)-2'-amino-6'-(4-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'S)-2'-amino-6'-(4-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8608495 |
| Molecular Formula | C16H14FN4O2+ |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (1'S,5'R,6'S)-2'-amino-6'-(4-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@]1(c2ccc(F)cc2)[C@]2(C#N)C(N)=[NH+]C3(OCCO3)[C@@]21C#N |
| InChI | InChI=1S/C16H13FN4O2/c1-13(10-2-4-11(17)5-3-10)14(8-18)12(20)21-16(15(13,14)9-19)22-6-7-23-16/h2-5H,6-7H2,1H3,(H2,20,21)/p+1/t13-,14-,15+/m0/s1 |
| InChIKey | NYMLBMYLVQCNOX-SOUVJXGZSA-O |
| XLogP | -0.73 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |