C18H18FN4O2+ — CID 8609828
(1'S,2R,4S,5'R,6'R)-2'-amino-6'-ethyl-6'-(4-fluorophenyl)-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609828) has the molecular formula C18H18FN4O2+ and a molecular weight of 341.37 g/mol. Its IUPAC name is (1'S,2R,4S,5'R,6'R)-2'-amino-6'-ethyl-6'-(4-fluorophenyl)-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4S,5'R,6'R)-2'-amino-6'-ethyl-6'-(4-fluorophenyl)-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609828 |
| Molecular Formula | C18H18FN4O2+ |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (1'S,2R,4S,5'R,6'R)-2'-amino-6'-ethyl-6'-(4-fluorophenyl)-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | CC[C@@]1(c2ccc(F)cc2)[C@]2(C#N)C(N)=[NH+][C@@]3(OC[C@H](C)O3)[C@@]21C#N |
| InChI | InChI=1S/C18H17FN4O2/c1-3-15(12-4-6-13(19)7-5-12)16(9-20)14(22)23-18(17(15,16)10-21)24-8-11(2)25-18/h4-7,11H,3,8H2,1-2H3,(H2,22,23)/p+1/t11-,15+,16-,17+,18+/m0/s1 |
| InChIKey | ASMUQNNIBICQEL-AHSWMOHISA-O |
| XLogP | 0.05 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |