C24H23N4O2+ — CID 8609513
(1'S,2R,4R,5'R)-2'-amino-6',6'-dibenzyl-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609513) has the molecular formula C24H23N4O2+ and a molecular weight of 399.47 g/mol. Its IUPAC name is (1'S,2R,4R,5'R)-2'-amino-6',6'-dibenzyl-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4R,5'R)-2'-amino-6',6'-dibenzyl-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609513 |
| Molecular Formula | C24H23N4O2+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (1'S,2R,4R,5'R)-2'-amino-6',6'-dibenzyl-4-methylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@@H]1CO[C@@]2([NH+]=C(N)[C@@]3(C#N)C(Cc4ccccc4)(Cc4ccccc4)[C@@]23C#N)O1 |
| InChI | InChI=1S/C24H22N4O2/c1-17-14-29-24(30-17)23(16-26)21(12-18-8-4-2-5-9-18,13-19-10-6-3-7-11-19)22(23,15-25)20(27)28-24/h2-11,17H,12-14H2,1H3,(H2,27,28)/p+1/t17-,22+,23-,24-/m1/s1 |
| InChIKey | CIODCDLEYOEZHD-TXCSNJEZSA-O |
| XLogP | 1.03 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |