C18H19N4O2+ — CID 8609542
(1'S,2R,4S,5'R,6'S)-2'-amino-6'-benzyl-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609542) has the molecular formula C18H19N4O2+ and a molecular weight of 323.38 g/mol. Its IUPAC name is (1'S,2R,4S,5'R,6'S)-2'-amino-6'-benzyl-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4S,5'R,6'S)-2'-amino-6'-benzyl-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609542 |
| Molecular Formula | C18H19N4O2+ |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (1'S,2R,4S,5'R,6'S)-2'-amino-6'-benzyl-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@H]1CO[C@@]2([NH+]=C(N)[C@@]3(C#N)[C@](C)(Cc4ccccc4)[C@@]23C#N)O1 |
| InChI | InChI=1S/C18H18N4O2/c1-12-9-23-18(24-12)17(11-20)15(2,8-13-6-4-3-5-7-13)16(17,10-19)14(21)22-18/h3-7,12H,8-9H2,1-2H3,(H2,21,22)/p+1/t12-,15-,16-,17+,18+/m0/s1 |
| InChIKey | OBABZBTWUXRBBT-VDMKFOLZSA-O |
| XLogP | -0.19 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |