C23H21N4O2+ — CID 8609867
(1'S,2R,4R,5'R,6'S)-2'-amino-4,6'-dimethyl-6'-(4-phenylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609867) has the molecular formula C23H21N4O2+ and a molecular weight of 385.45 g/mol. Its IUPAC name is (1'S,2R,4R,5'R,6'S)-2'-amino-4,6'-dimethyl-6'-(4-phenylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4R,5'R,6'S)-2'-amino-4,6'-dimethyl-6'-(4-phenylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609867 |
| Molecular Formula | C23H21N4O2+ |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (1'S,2R,4R,5'R,6'S)-2'-amino-4,6'-dimethyl-6'-(4-phenylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@@H]1CO[C@@]2([NH+]=C(N)[C@@]3(C#N)[C@](C)(c4ccc(-c5ccccc5)cc4)[C@@]23C#N)O1 |
| InChI | InChI=1S/C23H20N4O2/c1-15-12-28-23(29-15)22(14-25)20(2,21(22,13-24)19(26)27-23)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,15H,12H2,1-2H3,(H2,26,27)/p+1/t15-,20+,21+,22-,23-/m1/s1 |
| InChIKey | VYPJYHIVBHOISV-RMVDANIJSA-O |
| XLogP | 1.19 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |