C17H16BrN4O2+ — CID 8609697
(1'S,2R,4R,5'R,6'S)-2'-amino-6'-(4-bromophenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609697) has the molecular formula C17H16BrN4O2+ and a molecular weight of 388.25 g/mol. Its IUPAC name is (1'S,2R,4R,5'R,6'S)-2'-amino-6'-(4-bromophenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4R,5'R,6'S)-2'-amino-6'-(4-bromophenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609697 |
| Molecular Formula | C17H16BrN4O2+ |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (1'S,2R,4R,5'R,6'S)-2'-amino-6'-(4-bromophenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@@H]1CO[C@@]2([NH+]=C(N)[C@@]3(C#N)[C@](C)(c4ccc(Br)cc4)[C@@]23C#N)O1 |
| InChI | InChI=1S/C17H15BrN4O2/c1-10-7-23-17(24-10)16(9-20)14(2,11-3-5-12(18)6-4-11)15(16,8-19)13(21)22-17/h3-6,10H,7H2,1-2H3,(H2,21,22)/p+1/t10-,14+,15+,16-,17-/m1/s1 |
| InChIKey | YNZVDFYNIHDWGA-GFVQHMJJSA-O |
| XLogP | 0.28 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |