C18H20BrN4O2+ — CID 8610367
(1S,5R,6S)-2-amino-6-(4-bromophenyl)-4,4-diethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 8610367) has the molecular formula C18H20BrN4O2+ and a molecular weight of 404.29 g/mol. Its IUPAC name is (1S,5R,6S)-2-amino-6-(4-bromophenyl)-4,4-diethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6S)-2-amino-6-(4-bromophenyl)-4,4-diethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8610367 |
| Molecular Formula | C18H20BrN4O2+ |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (1S,5R,6S)-2-amino-6-(4-bromophenyl)-4,4-diethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)[NH+]=C(N)[C@@]2(C#N)[C@](C)(c3ccc(Br)cc3)[C@@]12C#N |
| InChI | InChI=1S/C18H19BrN4O2/c1-4-24-18(25-5-2)17(11-21)15(3,12-6-8-13(19)9-7-12)16(17,10-20)14(22)23-18/h6-9H,4-5H2,1-3H3,(H2,22,23)/p+1/t15-,16-,17+/m0/s1 |
| InChIKey | AZLLPRLQFDGLAR-YESZJQIVSA-O |
| XLogP | 0.92 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|