C17H17N4O2S+ — CID 8607902
(1'S,2R,5'R,6'S)-2'-amino-6'-(4-methoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8607902) has the molecular formula C17H17N4O2S+ and a molecular weight of 341.42 g/mol. Its IUPAC name is (1'S,2R,5'R,6'S)-2'-amino-6'-(4-methoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(4-methoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8607902 |
| Molecular Formula | C17H17N4O2S+ |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(4-methoxyphenyl)-6'-methylspiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | COc1ccc([C@@]2(C)[C@]3(C#N)C(N)=[NH+][C@@]4(OCCS4)[C@@]32C#N)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-14(11-3-5-12(22-2)6-4-11)15(9-18)13(20)21-17(16(14,15)10-19)23-7-8-24-17/h3-6H,7-8H2,1-2H3,(H2,20,21)/p+1/t14-,15-,16+,17+/m0/s1 |
| InChIKey | BYOFUAFHKPISGF-MWDXBVQZSA-O |
| XLogP | -0.14 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |