C18H21N4O4+ — CID 8608988
(1S,5R,6S)-2-amino-6-(2,5-dimethoxyphenyl)-4,4-dimethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 8608988) has the molecular formula C18H21N4O4+ and a molecular weight of 357.39 g/mol. Its IUPAC name is (1S,5R,6S)-2-amino-6-(2,5-dimethoxyphenyl)-4,4-dimethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6S)-2-amino-6-(2,5-dimethoxyphenyl)-4,4-dimethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8608988 |
| Molecular Formula | C18H21N4O4+ |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (1S,5R,6S)-2-amino-6-(2,5-dimethoxyphenyl)-4,4-dimethoxy-6-methyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | COc1ccc(OC)c([C@]2(C)[C@]3(C#N)C(N)=[NH+]C(OC)(OC)[C@@]32C#N)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-15(12-8-11(23-2)6-7-13(12)24-3)16(9-19)14(21)22-18(25-4,26-5)17(15,16)10-20/h6-8H,1-5H3,(H2,21,22)/p+1/t15-,16+,17-/m1/s1 |
| InChIKey | LIGKEJIUKWIUOF-IXDOHACOSA-O |
| XLogP | -0.61 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|