C16H13BrN4O2 — CID 8608488
(1'S,5'R,6'R)-2'-amino-6'-(4-bromophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8608488) has the molecular formula C16H13BrN4O2 and a molecular weight of 373.21 g/mol. Its IUPAC name is (1'S,5'R,6'R)-2'-amino-6'-(4-bromophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'R)-2'-amino-6'-(4-bromophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8608488 |
| Molecular Formula | C16H13BrN4O2 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | (1'S,5'R,6'R)-2'-amino-6'-(4-bromophenyl)-6'-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@@]1(c2ccc(Br)cc2)[C@]2(C#N)C(N)=NC3(OCCO3)[C@@]21C#N |
| InChI | InChI=1S/C16H13BrN4O2/c1-13(10-2-4-11(17)5-3-10)14(8-18)12(20)21-16(15(13,14)9-19)22-6-7-23-16/h2-5H,6-7H2,1H3,(H2,20,21)/t13-,14+,15-/m1/s1 |
| InChIKey | AJDLKVSPJJJKKW-QLFBSQMISA-N |
| XLogP | 1.81 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |