C19H20N4O4 — CID 8609625
(1'S,2R,4R,5'R,6'S)-2'-amino-6'-(3,4-dimethoxyphenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609625) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (1'S,2R,4R,5'R,6'S)-2'-amino-6'-(3,4-dimethoxyphenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4R,5'R,6'S)-2'-amino-6'-(3,4-dimethoxyphenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609625 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (1'S,2R,4R,5'R,6'S)-2'-amino-6'-(3,4-dimethoxyphenyl)-4,6'-dimethylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | COc1ccc([C@@]2(C)[C@]3(C#N)C(N)=N[C@@]4(OC[C@@H](C)O4)[C@@]32C#N)cc1OC |
| InChI | InChI=1S/C19H20N4O4/c1-11-8-26-19(27-11)18(10-21)16(2,17(18,9-20)15(22)23-19)12-5-6-13(24-3)14(7-12)25-4/h5-7,11H,8H2,1-4H3,(H2,22,23)/t11-,16+,17+,18-,19-/m1/s1 |
| InChIKey | DUTOKLSHBYBEMQ-BBVHWWONSA-N |
| XLogP | 1.45 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |