C21H23N4O2+ — CID 8609975
CID 8609975 (PubChem CID 8609975) has the molecular formula C21H23N4O2+ and a molecular weight of 363.44 g/mol.
| Compound Name | CID 8609975 |
|---|---|
| PubChem CID | 8609975 |
| Molecular Formula | C21H23N4O2+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | — |
| SMILES | C[C@H]1CO[C@@]2([NH+]=C(N)[C@@]3(C#N)C4(CCC(c5ccccc5)CC4)[C@@]23C#N)O1 |
| InChI | InChI=1S/C21H22N4O2/c1-14-11-26-21(27-14)20(13-23)18(19(20,12-22)17(24)25-21)9-7-16(8-10-18)15-5-3-2-4-6-15/h2-6,14,16H,7-11H2,1H3,(H2,24,25)/p+1/t14-,16?,18?,19-,20+,21+/m0/s1 |
| InChIKey | NTZMNGGJIFHZCR-ZNZUWACASA-O |
| XLogP | 0.90 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |