C17H16ClN4O2+ — CID 8608554
(1'S,5'R,6'R)-2'-amino-6'-(3-chlorophenyl)-6'-ethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8608554) has the molecular formula C17H16ClN4O2+ and a molecular weight of 343.79 g/mol. Its IUPAC name is (1'S,5'R,6'R)-2'-amino-6'-(3-chlorophenyl)-6'-ethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'R)-2'-amino-6'-(3-chlorophenyl)-6'-ethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8608554 |
| Molecular Formula | C17H16ClN4O2+ |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (1'S,5'R,6'R)-2'-amino-6'-(3-chlorophenyl)-6'-ethylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | CC[C@@]1(c2cccc(Cl)c2)[C@]2(C#N)C(N)=[NH+]C3(OCCO3)[C@@]21C#N |
| InChI | InChI=1S/C17H15ClN4O2/c1-2-14(11-4-3-5-12(18)8-11)15(9-19)13(21)22-17(16(14,15)10-20)23-6-7-24-17/h3-5,8H,2,6-7H2,1H3,(H2,21,22)/p+1/t14-,15+,16-/m1/s1 |
| InChIKey | WZWLLUXCFMRPCR-OWCLPIDISA-O |
| XLogP | 0.17 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |