C14H7ClN4 — CID 8610664
3-(3-chlorophenyl)-3-methylcyclopropane-1,1,2,2-tetracarbonitrile (PubChem CID 8610664) has the molecular formula C14H7ClN4 and a molecular weight of 266.69 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-methylcyclopropane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-(3-chlorophenyl)-3-methylcyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 8610664 |
| Molecular Formula | C14H7ClN4 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(3-chlorophenyl)-3-methylcyclopropane-1,1,2,2-tetracarbonitrile |
| SMILES | CC1(c2cccc(Cl)c2)C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C14H7ClN4/c1-12(10-3-2-4-11(15)5-10)13(6-16,7-17)14(12,8-18)9-19/h2-5H,1H3 |
| InChIKey | YOPVLNDWPAWEKE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|