C13H18ClNO2 — CID 67470964
(2S)-2-(3-chlorophenyl)-3,3,4-trimethylmorpholin-2-ol (PubChem CID 67470964) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-3,3,4-trimethylmorpholin-2-ol.
| Compound Name | (2S)-2-(3-chlorophenyl)-3,3,4-trimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 67470964 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-3,3,4-trimethylmorpholin-2-ol |
| SMILES | CN1CCO[C@@](O)(c2cccc(Cl)c2)C1(C)C |
| InChI | InChI=1S/C13H18ClNO2/c1-12(2)13(16,17-8-7-15(12)3)10-5-4-6-11(14)9-10/h4-6,9,16H,7-8H2,1-3H3/t13-/m0/s1 |
| InChIKey | PMRHGTJVVOGPAO-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |