C15H23ClN2O — CID 55019551
1-(3-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine (PubChem CID 55019551) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 55019551 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(3-chlorophenyl)-1-(2,2-dimethylmorpholin-4-yl)propan-2-amine |
| SMILES | CC(N)C(c1cccc(Cl)c1)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H23ClN2O/c1-11(17)14(12-5-4-6-13(16)9-12)18-7-8-19-15(2,3)10-18/h4-6,9,11,14H,7-8,10,17H2,1-3H3 |
| InChIKey | PLCDIPGJLMUHPT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |