C13H18ClNO2 — CID 82088856
1-(3-chlorophenyl)-2-(2-methyl-1,3-dioxan-2-yl)ethanamine (PubChem CID 82088856) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2-methyl-1,3-dioxan-2-yl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-2-(2-methyl-1,3-dioxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 82088856 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2-methyl-1,3-dioxan-2-yl)ethanamine |
| SMILES | CC1(CC(N)c2cccc(Cl)c2)OCCCO1 |
| InChI | InChI=1S/C13H18ClNO2/c1-13(16-6-3-7-17-13)9-12(15)10-4-2-5-11(14)8-10/h2,4-5,8,12H,3,6-7,9,15H2,1H3 |
| InChIKey | CSIXPQXJZZNIIN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |