C19H22ClN4O2+ — CID 8610434
(1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-diethoxy-6-ethyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 8610434) has the molecular formula C19H22ClN4O2+ and a molecular weight of 373.86 g/mol. Its IUPAC name is (1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-diethoxy-6-ethyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-diethoxy-6-ethyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8610434 |
| Molecular Formula | C19H22ClN4O2+ |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (1S,5R,6R)-2-amino-6-(3-chlorophenyl)-4,4-diethoxy-6-ethyl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)[NH+]=C(N)[C@@]2(C#N)[C@@](CC)(c3cccc(Cl)c3)[C@@]12C#N |
| InChI | InChI=1S/C19H21ClN4O2/c1-4-16(13-8-7-9-14(20)10-13)17(11-21)15(23)24-19(25-5-2,26-6-3)18(16,17)12-22/h7-10H,4-6H2,1-3H3,(H2,23,24)/p+1/t16-,17+,18-/m1/s1 |
| InChIKey | YYMCWMTUANDZMT-FGTMMUONSA-O |
| XLogP | 1.20 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|