C26H29N4OS2+ — CID 4176616
2-amino-6-(4-phenylmethoxyphenyl)-4,4-bis(propylsulfanyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 4176616) has the molecular formula C26H29N4OS2+ and a molecular weight of 477.68 g/mol. Its IUPAC name is 2-amino-6-(4-phenylmethoxyphenyl)-4,4-bis(propylsulfanyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-(4-phenylmethoxyphenyl)-4,4-bis(propylsulfanyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 4176616 |
| Molecular Formula | C26H29N4OS2+ |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-amino-6-(4-phenylmethoxyphenyl)-4,4-bis(propylsulfanyl)-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCSC1(SCCC)[NH+]=C(N)C2(C#N)C(c3ccc(OCc4ccccc4)cc3)C12C#N |
| InChI | InChI=1S/C26H28N4OS2/c1-3-14-32-26(33-15-4-2)25(18-28)22(24(25,17-27)23(29)30-26)20-10-12-21(13-11-20)31-16-19-8-6-5-7-9-19/h5-13,22H,3-4,14-16H2,1-2H3,(H2,29,30)/p+1 |
| InChIKey | ACJLDQASHGHCPL-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|