C25H26N4S2 — CID 3373747
2-amino-6-(4-phenylphenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3373747) has the molecular formula C25H26N4S2 and a molecular weight of 446.65 g/mol. Its IUPAC name is 2-amino-6-(4-phenylphenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-(4-phenylphenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3373747 |
| Molecular Formula | C25H26N4S2 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-amino-6-(4-phenylphenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCSC1(SCCC)N=C(N)C2(C#N)C(c3ccc(-c4ccccc4)cc3)C12C#N |
| InChI | InChI=1S/C25H26N4S2/c1-3-14-30-25(31-15-4-2)24(17-27)21(23(24,16-26)22(28)29-25)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h5-13,21H,3-4,14-15H2,1-2H3,(H2,28,29) |
| InChIKey | JNMVCHOOVZPUBT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|