C16H25N4O2+ — CID 8610107
(1S,5R,6R)-2-amino-4,4-diethoxy-6-pentan-3-yl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 8610107) has the molecular formula C16H25N4O2+ and a molecular weight of 305.40 g/mol. Its IUPAC name is (1S,5R,6R)-2-amino-4,4-diethoxy-6-pentan-3-yl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6R)-2-amino-4,4-diethoxy-6-pentan-3-yl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8610107 |
| Molecular Formula | C16H25N4O2+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (1S,5R,6R)-2-amino-4,4-diethoxy-6-pentan-3-yl-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)[NH+]=C(N)[C@@]2(C#N)[C@@H](C(CC)CC)[C@@]12C#N |
| InChI | InChI=1S/C16H24N4O2/c1-5-11(6-2)12-14(9-17)13(19)20-16(21-7-3,22-8-4)15(12,14)10-18/h11-12H,5-8H2,1-4H3,(H2,19,20)/p+1/t12-,14-,15-/m1/s1 |
| InChIKey | XKEUVBNDIKEXGJ-BPLDGKMQSA-O |
| XLogP | 0.25 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|