C23H28N2O4 — CID 139746826
methyl 2-[1-[3-(4-cyanobenzoyl)-2,2-dimethylpent-3-enoyl]piperidin-4-yl]acetate (PubChem CID 139746826) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 2-[1-[3-(4-cyanobenzoyl)-2,2-dimethylpent-3-enoyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[3-(4-cyanobenzoyl)-2,2-dimethylpent-3-enoyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 139746826 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl 2-[1-[3-(4-cyanobenzoyl)-2,2-dimethylpent-3-enoyl]piperidin-4-yl]acetate |
| SMILES | CC=C(C(=O)c1ccc(C#N)cc1)C(C)(C)C(=O)N1CCC(CC(=O)OC)CC1 |
| InChI | InChI=1S/C23H28N2O4/c1-5-19(21(27)18-8-6-17(15-24)7-9-18)23(2,3)22(28)25-12-10-16(11-13-25)14-20(26)29-4/h5-9,16H,10-14H2,1-4H3 |
| InChIKey | LGDUEFQKRCZHAL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|