C22H24N2O3 — CID 67800629
methyl 2-[1-[4-(2-pyridin-4-ylethenyl)benzoyl]piperidin-4-yl]acetate (PubChem CID 67800629) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is methyl 2-[1-[4-(2-pyridin-4-ylethenyl)benzoyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[4-(2-pyridin-4-ylethenyl)benzoyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 67800629 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | methyl 2-[1-[4-(2-pyridin-4-ylethenyl)benzoyl]piperidin-4-yl]acetate |
| SMILES | COC(=O)CC1CCN(C(=O)c2ccc(C=Cc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C22H24N2O3/c1-27-21(25)16-19-10-14-24(15-11-19)22(26)20-6-4-17(5-7-20)2-3-18-8-12-23-13-9-18/h2-9,12-13,19H,10-11,14-16H2,1H3 |
| InChIKey | NAPDNJJLVZOLSS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |