C26H29N3O5 — CID 139633151
methyl 2-[1-[4-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]benzoyl]piperidin-4-yl]acetate (PubChem CID 139633151) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is methyl 2-[1-[4-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]benzoyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[4-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]benzoyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 139633151 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | methyl 2-[1-[4-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]benzoyl]piperidin-4-yl]acetate |
| SMILES | [H]/N=C(\NC(=O)OCC=C)c1ccc(-c2ccc(C(=O)N3CCC(CC(=O)OC)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O5/c1-3-16-34-26(32)28-24(27)21-8-4-19(5-9-21)20-6-10-22(11-7-20)25(31)29-14-12-18(13-15-29)17-23(30)33-2/h3-11,18H,1,12-17H2,2H3,(H2,27,28,32) |
| InChIKey | PWOKJPSIHOXPNU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|