C24H33N5O5 — CID 19391640
methyl 2-[1-[4-[4-[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]phenyl]piperazine-1-carbonyl]piperidin-4-yl]acetate (PubChem CID 19391640) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is methyl 2-[1-[4-[4-[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]phenyl]piperazine-1-carbonyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[4-[4-[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]phenyl]piperazine-1-carbonyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 19391640 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | methyl 2-[1-[4-[4-[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]phenyl]piperazine-1-carbonyl]piperidin-4-yl]acetate |
| SMILES | C=CCOC(=O)/N=C(/N)c1ccc(N2CCN(C(=O)N3CCC(CC(=O)OC)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H33N5O5/c1-3-16-34-23(31)26-22(25)19-4-6-20(7-5-19)27-12-14-29(15-13-27)24(32)28-10-8-18(9-11-28)17-21(30)33-2/h3-7,18H,1,8-17H2,2H3,(H2,25,26,31) |
| InChIKey | LVBAZCFDEIIIAQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|