C23H35N5O3 — CID 19391542
2-methylpropyl 2-[1-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]piperidin-4-yl]acetate (PubChem CID 19391542) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-methylpropyl 2-[1-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]piperidin-4-yl]acetate.
| Compound Name | 2-methylpropyl 2-[1-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 19391542 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-methylpropyl 2-[1-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]piperidin-4-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C(=O)N3CCC(CC(=O)OCC(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H35N5O3/c1-17(2)16-31-21(29)15-18-7-9-27(10-8-18)23(30)28-13-11-26(12-14-28)20-5-3-19(4-6-20)22(24)25/h3-6,17-18H,7-16H2,1-2H3,(H3,24,25) |
| InChIKey | CSLSWCZSUKCBGQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|