C26H35Cl2N5O3 — CID 19391597
4-[benzyl-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;dihydrochloride (PubChem CID 19391597) has the molecular formula C26H35Cl2N5O3 and a molecular weight of 536.50 g/mol. Its IUPAC name is 4-[benzyl-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;dihydrochloride.
| Compound Name | 4-[benzyl-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 19391597 |
| Molecular Formula | C26H35Cl2N5O3 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 4-[benzyl-[4-(4-carbamimidoylphenyl)piperazine-1-carbonyl]amino]cyclohexane-1-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(N2CCN(C(=O)N(Cc3ccccc3)C3CCC(C(=O)O)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H33N5O3.2ClH/c27-24(28)20-6-10-22(11-7-20)29-14-16-30(17-15-29)26(34)31(18-19-4-2-1-3-5-19)23-12-8-21(9-13-23)25(32)33;;/h1-7,10-11,21,23H,8-9,12-18H2,(H3,27,28)(H,32,33);2*1H |
| InChIKey | RNJOAMRCSIJRSS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|