C27H39N5O5 — CID 19391702
methyl 4-[[4-(4-carbamimidoylphenyl)piperidine-1-carbonyl]-(2-morpholin-4-yl-2-oxoethyl)amino]cyclohexane-1-carboxylate (PubChem CID 19391702) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is methyl 4-[[4-(4-carbamimidoylphenyl)piperidine-1-carbonyl]-(2-morpholin-4-yl-2-oxoethyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[4-(4-carbamimidoylphenyl)piperidine-1-carbonyl]-(2-morpholin-4-yl-2-oxoethyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19391702 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | methyl 4-[[4-(4-carbamimidoylphenyl)piperidine-1-carbonyl]-(2-morpholin-4-yl-2-oxoethyl)amino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(C2CCN(C(=O)N(CC(=O)N3CCOCC3)C3CCC(C(=O)OC)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H39N5O5/c1-36-26(34)22-6-8-23(9-7-22)32(18-24(33)30-14-16-37-17-15-30)27(35)31-12-10-20(11-13-31)19-2-4-21(5-3-19)25(28)29/h2-5,20,22-23H,6-18H2,1H3,(H3,28,29) |
| InChIKey | XEZITEIJYKZAFD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|