C27H32N4O3 — CID 19391676
4-[benzyl-[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 19391676) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-[benzyl-[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[benzyl-[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19391676 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 4-[benzyl-[4-(4-carbamimidoylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=CCN(C(=O)N(Cc3ccccc3)C3CCC(C(=O)O)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O3/c28-25(29)22-8-6-20(7-9-22)21-14-16-30(17-15-21)27(34)31(18-19-4-2-1-3-5-19)24-12-10-23(11-13-24)26(32)33/h1-9,14,23-24H,10-13,15-18H2,(H3,28,29)(H,32,33) |
| InChIKey | XHSCISSNPWSQKI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|