C23H28N6O2 — CID 19921545
4-[[[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]-methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 19921545) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-[[[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]-methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]-methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19921545 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4-[[[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]-methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3ccc(N(C)CC4CCC(C(=O)O)CC4)nc3n2C)cc1 |
| InChI | InChI=1S/C23H28N6O2/c1-28(13-14-3-5-17(6-4-14)23(30)31)19-12-11-18-22(27-19)29(2)21(26-18)16-9-7-15(8-10-16)20(24)25/h7-12,14,17H,3-6,13H2,1-2H3,(H3,24,25)(H,30,31) |
| InChIKey | ZFPCEDSZXRDMFV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|