C22H26N6O2 — CID 19921153
methyl 2-[1-[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]piperidin-4-yl]acetate (PubChem CID 19921153) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is methyl 2-[1-[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 19921153 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | methyl 2-[1-[2-(4-carbamimidoylphenyl)-3-methylimidazo[4,5-b]pyridin-5-yl]piperidin-4-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3ccc(N4CCC(CC(=O)OC)CC4)nc3n2C)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-27-21(16-5-3-15(4-6-16)20(23)24)25-17-7-8-18(26-22(17)27)28-11-9-14(10-12-28)13-19(29)30-2/h3-8,14H,9-13H2,1-2H3,(H3,23,24) |
| InChIKey | TTYBLEYILXKWBF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|