C22H29N3O3 — CID 54402631
methyl 4-[[4-(4-cyanophenyl)piperidine-1-carbonyl]-methylamino]cyclohexane-1-carboxylate (PubChem CID 54402631) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 4-[[4-(4-cyanophenyl)piperidine-1-carbonyl]-methylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[4-(4-cyanophenyl)piperidine-1-carbonyl]-methylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54402631 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | methyl 4-[[4-(4-cyanophenyl)piperidine-1-carbonyl]-methylamino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(N(C)C(=O)N2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-24(20-9-7-19(8-10-20)21(26)28-2)22(27)25-13-11-18(12-14-25)17-5-3-16(15-23)4-6-17/h3-6,18-20H,7-14H2,1-2H3 |
| InChIKey | VOMYBGBBZOCQNN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |