C20H30N4O3 — CID 19391636
4-[[4-[4-(aminomethyl)phenyl]piperazine-1-carbonyl]-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 19391636) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[[4-[4-(aminomethyl)phenyl]piperazine-1-carbonyl]-methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[4-[4-(aminomethyl)phenyl]piperazine-1-carbonyl]-methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19391636 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 4-[[4-[4-(aminomethyl)phenyl]piperazine-1-carbonyl]-methylamino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)N1CCN(c2ccc(CN)cc2)CC1)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-22(17-8-4-16(5-9-17)19(25)26)20(27)24-12-10-23(11-13-24)18-6-2-15(14-21)3-7-18/h2-3,6-7,16-17H,4-5,8-14,21H2,1H3,(H,25,26) |
| InChIKey | FPNTYODLFZGYFG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|