C21H31N3O3 — CID 19391688
methyl 4-[[1-[4-(aminomethyl)phenyl]piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 19391688) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is methyl 4-[[1-[4-(aminomethyl)phenyl]piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[1-[4-(aminomethyl)phenyl]piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19391688 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | methyl 4-[[1-[4-(aminomethyl)phenyl]piperidine-4-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)C2CCN(c3ccc(CN)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H31N3O3/c1-27-21(26)17-4-6-18(7-5-17)23-20(25)16-10-12-24(13-11-16)19-8-2-15(14-22)3-9-19/h2-3,8-9,16-18H,4-7,10-14,22H2,1H3,(H,23,25) |
| InChIKey | SNCNKVPNCUBBTH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|