C22H33N3O3 — CID 139645833
methyl 4-[[2-[1-[4-(aminomethyl)phenyl]piperidin-4-yl]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 139645833) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is methyl 4-[[2-[1-[4-(aminomethyl)phenyl]piperidin-4-yl]acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[2-[1-[4-(aminomethyl)phenyl]piperidin-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139645833 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | methyl 4-[[2-[1-[4-(aminomethyl)phenyl]piperidin-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)CC2CCN(c3ccc(CN)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O3/c1-28-22(27)18-4-6-19(7-5-18)24-21(26)14-16-10-12-25(13-11-16)20-8-2-17(15-23)3-9-20/h2-3,8-9,16,18-19H,4-7,10-15,23H2,1H3,(H,24,26) |
| InChIKey | BBGUPJNBXADRJO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|