C30H32ClN3O8 — CID 173333564
methyl 3-[4-[3-methoxy-5-oxo-1-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]-2H-pyrrol-4-yl]phenyl]propanoate;prop-2-enyl carbonochloridate (PubChem CID 173333564) has the molecular formula C30H32ClN3O8 and a molecular weight of 598.05 g/mol. Its IUPAC name is methyl 3-[4-[3-methoxy-5-oxo-1-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]-2H-pyrrol-4-yl]phenyl]propanoate;prop-2-enyl carbonochloridate.
| Compound Name | methyl 3-[4-[3-methoxy-5-oxo-1-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]-2H-pyrrol-4-yl]phenyl]propanoate;prop-2-enyl carbonochloridate |
|---|---|
| PubChem CID | 173333564 |
| Molecular Formula | C30H32ClN3O8 |
| Molecular Weight | 598.05 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | methyl 3-[4-[3-methoxy-5-oxo-1-[4-(N-prop-2-enoxycarbonylcarbamimidoyl)phenyl]-2H-pyrrol-4-yl]phenyl]propanoate;prop-2-enyl carbonochloridate |
| SMILES | C=CCOC(=O)Cl.[H]/N=C(\NC(=O)OCC=C)c1ccc(N2CC(OC)=C(c3ccc(CCC(=O)OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O6.C4H5ClO2/c1-4-15-35-26(32)28-24(27)19-10-12-20(13-11-19)29-16-21(33-2)23(25(29)31)18-8-5-17(6-9-18)7-14-22(30)34-3;1-2-3-7-4(5)6/h4-6,8-13H,1,7,14-16H2,2-3H3,(H2,27,28,32);2H,1,3H2 |
| InChIKey | MXFBFAINLWDKFL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|