C21H21N3O4S — CID 67878703
methyl 2-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2H-pyrrol-4-yl]phenyl]sulfanylacetate (PubChem CID 67878703) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl 2-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2H-pyrrol-4-yl]phenyl]sulfanylacetate.
| Compound Name | methyl 2-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2H-pyrrol-4-yl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 67878703 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl 2-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2H-pyrrol-4-yl]phenyl]sulfanylacetate |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(OC)=C(c3ccc(SCC(=O)OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4S/c1-27-17-11-24(15-7-3-14(4-8-15)20(22)23)21(26)19(17)13-5-9-16(10-6-13)29-12-18(25)28-2/h3-10H,11-12H2,1-2H3,(H3,22,23) |
| InChIKey | QKKFSPNVOYWAAS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|