C23H26ClN3O4 — CID 18991098
methyl 3-[4-[3-methoxy-1-[4-(N'-methylcarbamimidoyl)phenyl]-5-oxo-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride (PubChem CID 18991098) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is methyl 3-[4-[3-methoxy-1-[4-(N'-methylcarbamimidoyl)phenyl]-5-oxo-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[3-methoxy-1-[4-(N'-methylcarbamimidoyl)phenyl]-5-oxo-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 18991098 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | methyl 3-[4-[3-methoxy-1-[4-(N'-methylcarbamimidoyl)phenyl]-5-oxo-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride |
| SMILES | C/N=C(\N)c1ccc(N2CC(OC)=C(c3ccc(CCC(=O)OC)cc3)C2=O)cc1.Cl |
| InChI | InChI=1S/C23H25N3O4.ClH/c1-25-22(24)17-9-11-18(12-10-17)26-14-19(29-2)21(23(26)28)16-7-4-15(5-8-16)6-13-20(27)30-3;/h4-5,7-12H,6,13-14H2,1-3H3,(H2,24,25);1H |
| InChIKey | UIGUOVDSXPCJAC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|