C28H28ClN3O4 — CID 18990895
methyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2-phenyl-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride (PubChem CID 18990895) has the molecular formula C28H28ClN3O4 and a molecular weight of 506.00 g/mol. Its IUPAC name is methyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2-phenyl-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2-phenyl-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 18990895 |
| Molecular Formula | C28H28ClN3O4 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | methyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methoxy-5-oxo-2-phenyl-2H-pyrrol-4-yl]phenyl]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2C(=O)C(c3ccc(CCC(=O)OC)cc3)=C(OC)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O4.ClH/c1-34-23(32)17-10-18-8-11-19(12-9-18)24-26(35-2)25(20-6-4-3-5-7-20)31(28(24)33)22-15-13-21(14-16-22)27(29)30;/h3-9,11-16,25H,10,17H2,1-2H3,(H3,29,30);1H |
| InChIKey | RIUQDONQBZAKHM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|