C25H30N4O4 — CID 67879918
(2-amino-2-oxoethyl) 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]-2-methylpropanoate (PubChem CID 67879918) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]-2-methylpropanoate.
| Compound Name | (2-amino-2-oxoethyl) 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 67879918 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]-2-methylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(C(=O)N3CCC(C(C)(C)C(=O)OCC(N)=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-25(2,24(32)33-15-21(26)30)20-11-13-29(14-12-20)23(31)19-9-5-17(6-10-19)16-3-7-18(8-4-16)22(27)28/h3-10,20H,11-15H2,1-2H3,(H2,26,30)(H3,27,28) |
| InChIKey | NAQIWWSWHPHNTK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|