C28H21NO5 — CID 146163882
ethyl 4-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1H-pyrrole-3-carboxylate (PubChem CID 146163882) has the molecular formula C28H21NO5 and a molecular weight of 451.48 g/mol. Its IUPAC name is ethyl 4-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 146163882 |
| Molecular Formula | C28H21NO5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | ethyl 4-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)[nH]c(-c2ccccc2)c1-c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C28H21NO5/c1-2-33-27(31)22-21(23-26(30)19-15-9-10-16-20(19)34-28(23)32)24(17-11-5-3-6-12-17)29-25(22)18-13-7-4-8-14-18/h3-16,29-30H,2H2,1H3 |
| InChIKey | KVDODSIQUJFHCV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|