C25H17FO4 — CID 10938218
2-(4-fluorophenyl)-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one (PubChem CID 10938218) has the molecular formula C25H17FO4 and a molecular weight of 400.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 10938218 |
| Molecular Formula | C25H17FO4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one |
| SMILES | COc1ccc(C2C=C(c3ccc(F)cc3)Oc3c2c(=O)oc2ccccc32)cc1 |
| InChI | InChI=1S/C25H17FO4/c1-28-18-12-8-15(9-13-18)20-14-22(16-6-10-17(26)11-7-16)29-24-19-4-2-3-5-21(19)30-25(27)23(20)24/h2-14,20H,1H3 |
| InChIKey | NJPKHDSEAALQCQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|