C24H13BrClFO3 — CID 132968828
2-(4-bromophenyl)-4-(2-chloro-6-fluorophenyl)-4H-pyrano[3,2-c]chromen-5-one (PubChem CID 132968828) has the molecular formula C24H13BrClFO3 and a molecular weight of 483.72 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-(2-chloro-6-fluorophenyl)-4H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 2-(4-bromophenyl)-4-(2-chloro-6-fluorophenyl)-4H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 132968828 |
| Molecular Formula | C24H13BrClFO3 |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | 2-(4-bromophenyl)-4-(2-chloro-6-fluorophenyl)-4H-pyrano[3,2-c]chromen-5-one |
| SMILES | O=c1oc2ccccc2c2c1C(c1c(F)cccc1Cl)C=C(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C24H13BrClFO3/c25-14-10-8-13(9-11-14)20-12-16(21-17(26)5-3-6-18(21)27)22-23(29-20)15-4-1-2-7-19(15)30-24(22)28/h1-12,16H |
| InChIKey | WDXPBXZSOGILEX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|