C19H10F2N2O3 — CID 3814793
2-amino-4-(2,3-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 3814793) has the molecular formula C19H10F2N2O3 and a molecular weight of 352.30 g/mol. Its IUPAC name is 2-amino-4-(2,3-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(2,3-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3814793 |
| Molecular Formula | C19H10F2N2O3 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-amino-4-(2,3-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)C1c1cccc(F)c1F |
| InChI | InChI=1S/C19H10F2N2O3/c20-12-6-3-5-10(16(12)21)14-11(8-22)18(23)26-17-9-4-1-2-7-13(9)25-19(24)15(14)17/h1-7,14H,23H2 |
| InChIKey | KJXQHVHPDILLKJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|