C26H18O6 — CID 26815278
(13R,17S,22S)-13-(4-methoxyphenyl)-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,18,20-heptaene-11,15-dione (PubChem CID 26815278) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is (13R,17S,22S)-13-(4-methoxyphenyl)-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,18,20-heptaene-11,15-dione.
| Compound Name | (13R,17S,22S)-13-(4-methoxyphenyl)-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,18,20-heptaene-11,15-dione |
|---|---|
| PubChem CID | 26815278 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (13R,17S,22S)-13-(4-methoxyphenyl)-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,18,20-heptaene-11,15-dione |
| SMILES | COc1ccc([C@@H]2C3=C(Oc4c2c(=O)oc2ccccc42)[C@H]2C=CC=C[C@@H]2OC3=O)cc1 |
| InChI | InChI=1S/C26H18O6/c1-29-15-12-10-14(11-13-15)20-21-23(16-6-2-4-8-18(16)30-25(21)27)32-24-17-7-3-5-9-19(17)31-26(28)22(20)24/h2-13,16,18,20H,1H3/t16-,18-,20+/m0/s1 |
| InChIKey | RXPQRHFMXYPCME-XKGZKEIXSA-N |
| XLogP | 4.25 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|